CAS 81653-77-2
:L-Proline, 4-(phenylthio)-, (4S)-
Description:
L-Proline, 4-(phenylthio)-, (4S)- is an amino acid derivative characterized by the presence of a proline backbone with a phenylthio group attached at the fourth carbon. This compound is classified as a chiral molecule, with the (4S) designation indicating the specific stereochemistry at the proline's chiral center. It typically exhibits properties common to amino acids, such as solubility in polar solvents and the ability to participate in various chemical reactions, including peptide bond formation. The phenylthio group enhances its reactivity and may influence its biological activity, making it of interest in medicinal chemistry and biochemistry. The compound's molecular structure allows for potential applications in drug design, particularly in the development of inhibitors or modulators of biological pathways. Additionally, its unique characteristics may contribute to its role in protein synthesis and enzyme function. As with many amino acid derivatives, the stability and reactivity of L-Proline, 4-(phenylthio)-, (4S)- can be influenced by environmental factors such as pH and temperature.
Formula:C11H13NO2S
InChI:InChI=1S/C11H13NO2S/c13-11(14)10-6-9(7-12-10)15-8-4-2-1-3-5-8/h1-5,9-10,12H,6-7H2,(H,13,14)/t9-,10-/m0/s1
InChI key:InChIKey=PCIUUPKYZVILEM-UWVGGRQHSA-N
SMILES:S([C@H]1C[C@@H](C(O)=O)NC1)C2=CC=CC=C2
Synonyms:- cis-4-(Phenylthio)-L-proline
- L-Proline, 4-(phenylthio)-, (4S)-
- (4S)-4-(Phenylthio)-L-proline
- L-Proline, 4-(phenylthio)-, cis-
- (2S,4S)-4-(Phenylthio)pyrrolidine-2-carboxylic acid
- Cis-4-phenylthio-L-proline (Zofenopril Intermediate)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
