CAS 81654-03-7

4,5-Dibromo-2-(trifluoromethyl)-1H-imidazole

Description:

4,5-Dibromo-2-(trifluoromethyl)-1H-imidazole is a heterocyclic organic compound characterized by its imidazole ring, which is a five-membered ring containing two nitrogen atoms. The presence of bromine atoms at the 4 and 5 positions contributes to its reactivity and potential applications in various chemical reactions. The trifluoromethyl group at the 2 position enhances the compound's lipophilicity and can influence its biological activity, making it of interest in medicinal chemistry. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its unique structure allows for potential applications in pharmaceuticals, agrochemicals, and materials science. Additionally, the presence of halogens can impart specific electronic properties, affecting the compound's interaction with biological targets or its behavior in synthetic pathways. Safety and handling precautions should be observed due to the presence of bromine and fluorine, which can pose health risks. Overall, 4,5-Dibromo-2-(trifluoromethyl)-1H-imidazole is a compound of interest for further research and development in various chemical fields.

Formula: C₄HBr₂F₃N₂

InChI: InChI=1S/C4HBr2F3N2/c5-1-2(6)11-3(10-1)4(7,8)9/h(H,10,11)

InChI key: InChIKey=ZIQQYRYCVXRBPE-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C=1NC(Br)=C(Br)N1

Synonyms:

• 1H-Imidazole, 4,5-dibromo-2-(trifluoromethyl)-
• 4,5-Dibromo-2-(trifluoromethyl)-1H-imidazole