
CAS 81654-47-9
:2,2,2-Trifluoro-N-[2-(4-methoxyphenyl)ethyl]acetamide
Description:
2,2,2-Trifluoro-N-[2-(4-methoxyphenyl)ethyl]acetamide, with the CAS number 81654-47-9, is a chemical compound characterized by its unique trifluoromethyl group and an acetamide functional group. This compound features a methoxy-substituted phenyl group, which contributes to its potential biological activity and solubility properties. The presence of trifluoromethyl groups often enhances the lipophilicity and metabolic stability of organic molecules, making them of interest in pharmaceutical applications. The acetamide moiety can participate in hydrogen bonding, influencing its interactions in biological systems. Typically, compounds like this may exhibit a range of properties, including moderate to high melting and boiling points, depending on their molecular weight and structure. Additionally, the presence of fluorine atoms can impart unique reactivity and stability characteristics. Overall, 2,2,2-Trifluoro-N-[2-(4-methoxyphenyl)ethyl]acetamide is a compound of interest in medicinal chemistry, potentially serving as a lead compound for further drug development or as a research tool in various chemical studies.
Formula:C11H12F3NO2
InChI:InChI=1S/C11H12F3NO2/c1-17-9-4-2-8(3-5-9)6-7-15-10(16)11(12,13)14/h2-5H,6-7H2,1H3,(H,15,16)
InChI key:InChIKey=WRLCLLXPCZJIIH-UHFFFAOYSA-N
SMILES:C(CNC(C(F)(F)F)=O)C1=CC=C(OC)C=C1
Synonyms:- N-Trifluoroacetyl-4-methoxyphenethylamine
- 2,2,2-Trifluoro-N-[2-[4-(methyloxy)phenyl]ethyl]acetamide
- 2,2,2-Trifluoro-N-[2-(4-methoxyphenyl)ethyl]acetamide
- Acetamide, 2,2,2-trifluoro-N-[2-(4-methoxyphenyl)ethyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.