![4-[2-(dipropylamino)ethyl]-7-hydroxy-1,3-dihydro-2H-indol-2-one](/_next/image/?url=https%3A%2Fstatic.cymitquimica.com%2Fcas-image%2Fthumb-webp%2F292821-4-2-dipropylamino-ethyl-7-hydroxy-13-dihydro-2h-indol-2-one.webp&w=3840&q=75)
CAS 81654-62-8
:4-[2-(dipropylamino)ethyl]-7-hydroxy-1,3-dihydro-2H-indol-2-one
Description:
4-[2-(Dipropylamino)ethyl]-7-hydroxy-1,3-dihydro-2H-indol-2-one, with the CAS number 81654-62-8, is a chemical compound that belongs to the class of indole derivatives. This substance features a complex structure characterized by an indole ring system, which is fused with a dihydro-2H-indolone moiety. The presence of a hydroxyl group at the 7-position contributes to its potential biological activity, while the dipropylamino group at the 4-position enhances its lipophilicity and may influence its pharmacological properties. This compound is of interest in medicinal chemistry due to its potential applications in drug development, particularly in the fields of neuropharmacology and psychopharmacology. Its unique structural features may allow it to interact with various biological targets, making it a candidate for further research. However, specific details regarding its solubility, stability, and reactivity would require empirical investigation to fully understand its characteristics and potential applications.
Formula:C16H24N2O2
InChI:InChI=1/C16H24N2O2/c1-3-8-18(9-4-2)10-7-12-5-6-14(19)16-13(12)11-15(20)17-16/h5-6,19H,3-4,7-11H2,1-2H3,(H,17,20)
SMILES:CCCN(CCC)CCc1ccc(c2c1CC(=N2)O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
