CymitQuimica logo

CAS 81672-33-5

:

Hexadecyl 4-pyridinecarboxylate

Description:
Hexadecyl 4-pyridinecarboxylate, with the CAS number 81672-33-5, is an organic compound characterized by its long hydrophobic hexadecyl chain and a pyridinecarboxylate functional group. This compound typically exhibits amphiphilic properties, making it soluble in both organic solvents and water to some extent, depending on the pH. The presence of the pyridine ring contributes to its potential as a ligand in coordination chemistry and its utility in various applications, including surfactants, emulsifiers, and in drug delivery systems. Hexadecyl 4-pyridinecarboxylate may also display antimicrobial properties, which can be advantageous in pharmaceutical and agricultural applications. Its molecular structure allows for interactions with biological membranes, influencing its behavior in biological systems. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as temperature and pH, which are important considerations in its practical applications. Overall, Hexadecyl 4-pyridinecarboxylate is a versatile compound with significant potential in various fields of chemistry and material science.
Formula:C22H37NO2
InChI:InChI=1S/C22H37NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-20-25-22(24)21-16-18-23-19-17-21/h16-19H,2-15,20H2,1H3
InChI key:InChIKey=STUBJXFCGLTLMA-UHFFFAOYSA-N
SMILES:C(OCCCCCCCCCCCCCCCC)(=O)C=1C=CN=CC1
Synonyms:
  • Hexadecyl 4-pyridinecarboxylate
  • Hexadecyl isonicotinate
  • 4-Pyridinecarboxylic acid, hexadecyl ester
  • 1-Hexadecyl isonicotinate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.