CymitQuimica logo

CAS 81690-92-8

:

N-acetyl-S-(3-amino-3-oxopropyl)-L-cysteine

Description:
N-acetyl-S-(3-amino-3-oxopropyl)-L-cysteine, identified by its CAS number 81690-92-8, is a derivative of the amino acid L-cysteine, which is known for its thiol group that plays a crucial role in various biochemical processes. This compound features an N-acetyl group, which enhances its stability and solubility, making it more bioavailable. The presence of the 3-amino-3-oxopropyl side chain suggests potential reactivity and interaction with other biomolecules, possibly influencing metabolic pathways or serving as a precursor in synthetic chemistry. Its structure indicates that it may participate in redox reactions due to the thiol group, which can form disulfide bonds, and it may also exhibit antioxidant properties. Additionally, compounds like this are often studied for their potential therapeutic applications, particularly in the context of cellular protection and modulation of biochemical pathways. Overall, N-acetyl-S-(3-amino-3-oxopropyl)-L-cysteine represents a unique chemical entity with potential implications in both research and medicine.
Formula:C8H14N2O4S
InChI:InChI=1/C8H14N2O4S/c1-5(11)10-6(8(13)14)4-15-3-2-7(9)12/h6H,2-4H2,1H3,(H2,9,12)(H,10,11)(H,13,14)/t6-/m0/s1
SMILES:CC(=N[C@@H](CSCCC(=N)O)C(=O)O)O
Synonyms:
  • L-cysteine, N-acetyl-S-(3-amino-3-oxopropyl)-
  • N-Acetyl-S-(3-amino-3-oxopropyl)-L-cysteine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 5 products.