CAS 81691-06-7
:3-Methyl-5-β-D-ribofuranosyl-2,4(1H,3H)-pyrimidinedione
Description:
3-Methyl-5-β-D-ribofuranosyl-2,4(1H,3H)-pyrimidinedione, also known by its CAS number 81691-06-7, is a nucleoside analog characterized by its pyrimidine structure, which includes a ribofuranosyl sugar moiety. This compound features a methyl group at the 3-position of the pyrimidine ring and is known for its potential biological activity, particularly in the context of antiviral and anticancer research. The presence of the ribofuranosyl group suggests that it may interact with nucleic acids, potentially influencing processes such as DNA or RNA synthesis. Its structural characteristics contribute to its solubility and stability, which are important for its biological efficacy. Additionally, the compound may exhibit specific interactions with enzymes or receptors due to its unique functional groups, making it a subject of interest in medicinal chemistry. Overall, 3-Methyl-5-β-D-ribofuranosyl-2,4(1H,3H)-pyrimidinedione represents a significant area of study for its potential therapeutic applications.
Formula:C10H14N2O6
InChI:InChI=1S/C10H14N2O6/c1-12-9(16)4(2-11-10(12)17)8-7(15)6(14)5(3-13)18-8/h2,5-8,13-15H,3H2,1H3,(H,11,17)/t5-,6-,7-,8+/m1/s1
InChI key:InChIKey=DXEJZRDJXRVUPN-XUTVFYLZSA-N
SMILES:O[C@H]1[C@@H](O[C@H](CO)[C@H]1O)C=2C(=O)N(C)C(=O)NC2
Synonyms:- 3-Methylpseudouridine
- 3-Methyl-5-β-D-ribofuranosyl-2,4(1H,3H)-pyrimidinedione
- 2,4(1H,3H)-Pyrimidinedione, 3-methyl-5-β-D-ribofuranosyl-
- NSC 363818
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
3-Methylpsedouridine
CAS:Nucleoside Derivatives - C-nucleosides, N-Methyl nucleosides; Naturally modified Ribo-nucleosidesFormula:C10H14N2O6Color and Shape:SolidMolecular weight:258.23Ref: TM-TNU0038
5mgTo inquire10mgTo inquire25mgTo inquire50mgTo inquire100mgTo inquire500mgTo inquire3-Methylpseudouridine
CAS:3-Methylpseudouridine is a uridine analog that inhibits the enzyme RNA polymerase. It has been shown to inhibit protein synthesis and can be used in the treatment of bacterial infections. 3-Methylpseudouridine is synthesized by solid-phase chemistry on a polymeric support and purified by high-performance liquid chromatography. It has been shown to inhibit the growth of bacteria in cell culture, but its effects on human cells are not known. 3-Methylpseudouridine also binds with high affinity to calf thymus DNA and it can be used as a substrate for aminoglycoside modification studies.Formula:C10H14N2O6Purity:Min. 95 Area-%Color and Shape:White PowderMolecular weight:258.23 g/mol3-Methylpseudouridine
CAS:Controlled ProductFormula:C10H14N2O6Color and Shape:NeatMolecular weight:258.228


