CAS 81702-31-0

(2S,5S)-2,5-Pyrrolidinedicarboxylic acid

Description:

(2S,5S)-2,5-Pyrrolidinedicarboxylic acid, also known as L-pyrrolidine-2,5-dicarboxylic acid, is a bicyclic organic compound characterized by its pyrrolidine ring structure with two carboxylic acid functional groups at the 2 and 5 positions. This compound is a chiral molecule, existing in specific stereoisomeric forms, with the (2S,5S) configuration being one of its enantiomers. It is typically a white to off-white crystalline solid, soluble in water and polar organic solvents due to the presence of the carboxylic acid groups, which can engage in hydrogen bonding. The compound is of interest in various fields, including pharmaceuticals and biochemistry, as it can serve as a building block for the synthesis of more complex molecules and may exhibit biological activity. Its properties, such as melting point and stability, can vary based on environmental conditions and the presence of other substances. As with many dicarboxylic acids, it may participate in various chemical reactions, including esterification and amidation.

Formula: C₆H₉NO₄

InChI: InChI=1/C6H9NO4/c8-5(9)3-1-2-4(7-3)6(10)11/h3-4,7H,1-2H2,(H,8,9)(H,10,11)/t3-,4-/m0/s1

SMILES: C1C[C@@H](C(=O)O)N[C@@H]1C(=O)O

Synonyms:

• (2S,5S)-Pyrrolidine-2,5-dicarboxylic acid
• 2,5-pyrrolidinedicarboxylic acid, (2S,5S)-