
CAS 81702-33-2
:D-Glucitol, 2-amino-1,4:3,6-dianhydro-2-deoxy-, hydrochloride (1:1)
Description:
D-Glucitol, 2-amino-1,4:3,6-dianhydro-2-deoxy-, hydrochloride (1:1), commonly known as a derivative of D-glucitol, is a chemical compound characterized by its amino and anhydro functionalities. It features a six-carbon sugar alcohol structure with an amino group at the second carbon and two anhydro groups, which contribute to its unique properties. This compound is typically encountered as a hydrochloride salt, enhancing its solubility in water and making it suitable for various applications in biochemistry and pharmaceuticals. The presence of the amino group suggests potential biological activity, possibly influencing metabolic pathways or serving as a precursor in synthetic chemistry. Its molecular structure allows for hydrogen bonding, which can affect its interactions with other biomolecules. As a hydrochloride, it is often more stable and easier to handle compared to its free base form. Overall, this compound is of interest in research related to carbohydrate chemistry and may have implications in medicinal chemistry due to its structural features.
Formula:C6H11NO3·ClH
InChI:InChI=1S/C6H11NO3.ClH/c7-3-1-9-6-4(8)2-10-5(3)6;/h3-6,8H,1-2,7H2;1H/t3-,4+,5+,6+;/m0./s1
InChI key:InChIKey=VSFKTMRKHVHYJE-BTVCFUMJSA-N
SMILES:N[C@@H]1[C@@]2([C@@]([C@H](O)CO2)(OC1)[H])[H].Cl
Synonyms:- D-Glucitol, 2-amino-1,4:3,6-dianhydro-2-deoxy-, hydrochloride
- D-Glucitol, 2-amino-1,4:3,6-dianhydro-2-deoxy-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.