CAS 81702-43-4
:(1S)-1-phenyl-2,3,4,5-tetrahydro-1H-3-benzazepine-7,8-diol hydrochloride
Description:
(1S)-1-phenyl-2,3,4,5-tetrahydro-1H-3-benzazepine-7,8-diol hydrochloride is a chemical compound characterized by its complex bicyclic structure, which includes a benzazepine core. This compound features a phenyl group and hydroxyl groups at the 7 and 8 positions, contributing to its potential biological activity. The presence of the hydrochloride salt form indicates that it is a hydrochloride salt, which often enhances solubility in water and may influence its pharmacokinetic properties. The stereochemistry is specified as (1S), indicating the configuration of the chiral center, which can significantly affect the compound's interactions with biological targets. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry and drug development. Its specific applications and effects would depend on further research and characterization, including studies on its efficacy, safety, and mechanism of action. As with many compounds in this class, it is essential to handle it with care, following appropriate safety protocols.
Formula:C16H17NO2
InChI:InChI=1/C16H17NO2.ClH/c18-15-8-12-6-7-17-10-14(13(12)9-16(15)19)11-4-2-1-3-5-11;/h1-5,8-9,14,17-19H,6-7,10H2;1H/t14-;/m0./s1
SMILES:c1ccc(cc1)[C@@H]1CNCCc2cc(c(cc12)O)O.Cl
Synonyms:- S-(a?’)-SKF-38393 hydrochloride
- S(-)-SKF-38393 HCL
- S(-)-SKF-38393 HYDROCHLORIDE
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
S-(−)-SKF-38393 hydrochloride
CAS:S-(−)-SKF-38393 hydrochloride is a D1 dopamine receptor agonist.Formula:C16H17NO2Color and Shape:SolidMolecular weight:255.31

