CAS 81705-04-6

N-(4-Aminobutyl)-5-chloro-2-naphthalenesulfonamide

Description:

N-(4-Aminobutyl)-5-chloro-2-naphthalenesulfonamide, identified by its CAS number 81705-04-6, is a chemical compound that features a naphthalene ring substituted with a sulfonamide group and a chloro atom. This compound is characterized by its sulfonamide functional group, which typically imparts properties such as solubility in polar solvents and potential biological activity. The presence of the amino group allows for hydrogen bonding, enhancing its reactivity and interaction with biological targets. The chloro substituent can influence the compound's electronic properties and steric hindrance, affecting its overall reactivity and stability. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of therapeutic agents. Its structural features suggest potential applications in various fields, including pharmaceuticals and agrochemicals. However, specific safety and handling guidelines should be followed due to the potential toxicity associated with sulfonamide derivatives.

Formula: C₁₄H₁₇ClN₂O₂S

InChI: InChI=1/C14H17ClN2O2S/c15-14-5-3-4-11-10-12(6-7-13(11)14)20(18,19)17-9-2-1-8-16/h3-7,10,17H,1-2,8-9,16H2

InChI key: InChIKey=JJQKICOADUKSNS-UHFFFAOYSA-N

SMILES: ClC=1C2=C(C=C(S(NCCCCN)(=O)=O)C=C2)C=CC1

Synonyms:

• 2-naphthalenesulfonamide, N-(4-aminobutyl)-5-chloro-
• N-(4-Aminobutyl)-5-chloro-2-naphthalenesulfonamide

N-(4-Aminobutyl)-5-chloronaphthalene-2-sulfonamide Hydrochloride

CAS: 81705-04-6, 88519-57-7

Formula: C₁₄H₁₇ClN₂O₂S·HCl

Purity: >98.0%(HPLC)(N)

Color and Shape: Light orange to Light red powder to crystalline

Molecular weight: 349.27

Ref: 3B-A2416