CymitQuimica logo

CAS 81705-06-8

:

(11beta)-11,17,20,21-tetrahydroxy-18,20-epoxypregn-4-en-3-one

Description:
The chemical substance known as (11beta)-11,17,20,21-tetrahydroxy-18,20-epoxypregn-4-en-3-one, with the CAS number 81705-06-8, is a steroid compound that exhibits a complex structure characterized by multiple hydroxyl groups and an epoxide functional group. This compound is derived from the pregnane steroid framework, which is common in various biological molecules, including hormones. The presence of hydroxyl groups suggests that it may participate in hydrogen bonding, influencing its solubility and reactivity. The epoxide group indicates potential for further chemical transformations, making it a reactive species in organic synthesis. This compound is of interest in pharmacology and biochemistry, particularly in studies related to steroid metabolism and the development of therapeutic agents. Its specific biological activities and mechanisms of action would depend on its interactions with biological targets, such as receptors or enzymes, which are often influenced by the stereochemistry and functional groups present in its structure.
Formula:C5H10O4
InChI:InChI=1/C5H10O4/c1-2-3(6)4(7)5(8)9/h3-4,6-7H,2H2,1H3,(H,8,9)
SMILES:CCC(C(C(=O)O)O)O
Synonyms:
  • Pregn-4-En-3-One, 18,20-Epoxy-11,17,20,21-Tetrahydroxy-, (11Beta)-
  • 4,5-Dideoxypentonic Acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.