CAS 817165-06-3

2,2′-[([1,1′-Biphenyl]-3-ylmethyl)imino]bis[ethanol]

Description:

2,2′-[([1,1′-Biphenyl]-3-ylmethyl)imino]bis[ethanol], identified by its CAS number 817165-06-3, is an organic compound characterized by its complex structure that includes a biphenyl moiety and two ethanol groups linked through an imino functional group. This compound typically exhibits properties associated with both aromatic and alcohol functionalities, which may influence its solubility, reactivity, and potential applications in various fields such as pharmaceuticals or materials science. The presence of the biphenyl structure suggests potential for π-π stacking interactions, while the ethanol groups may contribute to hydrogen bonding capabilities. As a result, this compound may display interesting physicochemical properties, including moderate to high melting and boiling points, depending on its molecular interactions. Its synthesis and characterization would involve standard organic chemistry techniques, and it may serve as a precursor or intermediate in the development of more complex chemical entities. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings.

Formula: C₁₇H₂₁NO₂

InChI: InChI=1S/C17H21NO2/c19-11-9-18(10-12-20)14-15-5-4-8-17(13-15)16-6-2-1-3-7-16/h1-8,13,19-20H,9-12,14H2

InChI key: InChIKey=XYYWPQCIUJKCTL-UHFFFAOYSA-N

SMILES: C(N(CCO)CCO)C=1C=C(C=CC1)C2=CC=CC=C2

Synonyms:

• 2,2′-[([1,1′-Biphenyl]-3-ylmethyl)imino]bis[ethanol]
• Ethanol, 2,2′-[([1,1′-biphenyl]-3-ylmethyl)imino]bis-
• 3-[[Bis(2-hydroxyethyl)amino]methyl]-1,1′-biphenyl

Bifeprunox Impurity 2

CAS: 817165-06-3

Formula: C₁₇H₂₁NO₂

Molecular weight: 271.36

Ref: 4Z-B-212003