
CAS 817172-27-3
:1-(6-Bromoimidazo[1,2-a]pyridin-2-yl)ethanone
Description:
1-(6-Bromoimidazo[1,2-a]pyridin-2-yl)ethanone is a chemical compound characterized by its unique structure, which includes an imidazo[1,2-a]pyridine moiety substituted with a bromine atom and an ethanone functional group. This compound typically exhibits properties associated with heterocyclic compounds, such as moderate to high solubility in organic solvents and potential reactivity due to the presence of the bromine atom, which can participate in nucleophilic substitution reactions. The imidazo[1,2-a]pyridine framework contributes to its biological activity, making it of interest in medicinal chemistry, particularly for its potential as a pharmacological agent. The presence of the ethanone group may also influence its reactivity and interactions with biological targets. Overall, this compound's characteristics, including its molecular structure, solubility, and reactivity, make it a subject of interest in various fields, including organic synthesis and drug development.
Formula:C9H7BrN2O
InChI:InChI=1S/C9H7BrN2O/c1-6(13)8-5-12-4-7(10)2-3-9(12)11-8/h2-5H,1H3
InChI key:InChIKey=XTXHRMDWOPCLHO-UHFFFAOYSA-N
SMILES:C(C)(=O)C=1N=C2N(C1)C=C(Br)C=C2
Synonyms:- 1-(6-Bromoimidazo[1,2-a]pyridin-2-yl)ethanone
- Ethanone, 1-(6-bromoimidazo[1,2-a]pyridin-2-yl)-
- 1-[6-Bromoimidazo[1,2-a]pyridin-2-yl]ethan-1-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.