CAS 817172-43-3
:8-Methyl-2-(3-nitrophenyl)imidazo[1,2-a]pyridine-3-carboxaldehyde
Description:
8-Methyl-2-(3-nitrophenyl)imidazo[1,2-a]pyridine-3-carboxaldehyde is a heterocyclic organic compound characterized by its imidazo-pyridine structure, which incorporates both a methyl group and a nitrophenyl substituent. This compound features a carboxaldehyde functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of the nitro group enhances its electron-withdrawing properties, which can influence its chemical behavior and interactions with other molecules. Typically, compounds of this nature may exhibit biological activity, making them of interest in medicinal chemistry and drug development. The imidazo[1,2-a]pyridine framework is known for its role in various pharmacological activities, including antimicrobial and anticancer properties. Additionally, the compound's solubility, stability, and reactivity can be affected by the substituents on the aromatic rings and the imidazole moiety. Overall, 8-Methyl-2-(3-nitrophenyl)imidazo[1,2-a]pyridine-3-carboxaldehyde represents a complex structure with potential utility in various chemical and biological applications.
Formula:C15H11N3O3
InChI:InChI=1S/C15H11N3O3/c1-10-4-3-7-17-13(9-19)14(16-15(10)17)11-5-2-6-12(8-11)18(20)21/h2-9H,1H3
InChI key:InChIKey=CYRAZYGNOQUEOO-UHFFFAOYSA-N
SMILES:C(=O)C1=C(N=C2N1C=CC=C2C)C3=CC(N(=O)=O)=CC=C3
Synonyms:- Imidazo[1,2-a]pyridine-3-carboxaldehyde, 8-methyl-2-(3-nitrophenyl)-
- 8-Methyl-2-(3-nitrophenyl)imidazo[1,2-a]pyridine-3-carboxaldehyde
- 8-METHYL-2-(3-NITRO-PHENYL)-IMIDAZO[1,2-A]PYRIDINE-3-CARBALDEHYDE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.