CAS 817172-45-5
:3-[2-(4-Methylphenyl)imidazo[1,2-a]pyridin-3-yl]-2-propenoic acid
Description:
3-[2-(4-Methylphenyl)imidazo[1,2-a]pyridin-3-yl]-2-propenoic acid, with the CAS number 817172-45-5, is a chemical compound characterized by its complex structure, which includes an imidazo[1,2-a]pyridine moiety and a propenoic acid functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential biological activity. The presence of the 4-methylphenyl group enhances its lipophilicity, which may influence its solubility and permeability in biological systems. The propenoic acid portion suggests potential reactivity, particularly in forming conjugates or participating in Michael addition reactions. Such compounds are often investigated for their pharmacological properties, including anti-cancer or anti-inflammatory activities. The specific interactions and mechanisms of action would depend on the compound's conformation and the presence of functional groups that facilitate binding to biological targets. Overall, this compound represents a class of heterocyclic compounds with potential applications in medicinal chemistry and drug development.
Formula:C17H14N2O2
InChI:InChI=1S/C17H14N2O2/c1-12-5-7-13(8-6-12)17-14(9-10-16(20)21)19-11-3-2-4-15(19)18-17/h2-11H,1H3,(H,20,21)
InChI key:InChIKey=GXSAGYCZQBHMCA-UHFFFAOYSA-N
SMILES:C(=CC(O)=O)C1=C(N=C2N1C=CC=C2)C3=CC=C(C)C=C3
Synonyms:- 2-Propenoic acid, 3-[2-(4-methylphenyl)imidazo[1,2-a]pyridin-3-yl]-
- 3-[2-(4-Methylphenyl)imidazo[1,2-a]pyridin-3-yl]-2-propenoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.