CAS 817172-46-6
:3-[2-(4-Chlorophenyl)imidazo[1,2-a]pyridin-3-yl]-2-propenoic acid
Description:
3-[2-(4-Chlorophenyl)imidazo[1,2-a]pyridin-3-yl]-2-propenoic acid, with the CAS number 817172-46-6, is a chemical compound characterized by its complex structure, which includes an imidazopyridine moiety and a propenoic acid functional group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential reactivity due to the presence of both aromatic and unsaturated functional groups. The chlorophenyl substituent may influence its biological activity and lipophilicity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The imidazo[1,2-a]pyridine structure is known for its role in various biological activities, including potential anti-cancer properties. Additionally, the propenoic acid component may contribute to its ability to participate in various chemical reactions, such as Michael additions or polymerization processes. Overall, this compound's unique structural features suggest it may have significant applications in drug discovery and development.
Formula:C16H11ClN2O2
InChI:InChI=1S/C16H11ClN2O2/c17-12-6-4-11(5-7-12)16-13(8-9-15(20)21)19-10-2-1-3-14(19)18-16/h1-10H,(H,20,21)
InChI key:InChIKey=LHNPJAJWNKTFSO-UHFFFAOYSA-N
SMILES:C(=CC(O)=O)C1=C(N=C2N1C=CC=C2)C3=CC=C(Cl)C=C3
Synonyms:- 3-[2-(4-Chlorophenyl)imidazo[1,2-a]pyridin-3-yl]-2-propenoic acid
- 2-Propenoic acid, 3-[2-(4-chlorophenyl)imidazo[1,2-a]pyridin-3-yl]-
- 3-[2-(4-CHLORO-PHENYL)-IMIDAZO[1,2-A]PYRIDIN-3-YL]ACRYLIC ACID
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.