CymitQuimica logo

CAS 817172-52-4

:

7-Methyl-2-(4-methylphenyl)-3-(1-piperazinylmethyl)imidazo[1,2-a]pyridine

Description:
7-Methyl-2-(4-methylphenyl)-3-(1-piperazinylmethyl)imidazo[1,2-a]pyridine is a chemical compound characterized by its complex structure, which includes an imidazopyridine core, a piperazine moiety, and a para-methylphenyl substituent. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in pharmaceutical research. The presence of the piperazine group suggests possible interactions with biological targets, particularly in the central nervous system, as piperazine derivatives are often associated with psychoactive effects. The imidazopyridine framework may contribute to its pharmacological profile, potentially influencing receptor binding and activity. Additionally, the methyl groups on the phenyl and imidazole rings can affect the compound's lipophilicity and metabolic stability. Overall, this compound's unique structural features may lead to diverse applications in medicinal chemistry, particularly in the development of novel therapeutic agents.
Formula:C20H24N4
InChI:InChI=1S/C20H24N4/c1-15-3-5-17(6-4-15)20-18(14-23-11-8-21-9-12-23)24-10-7-16(2)13-19(24)22-20/h3-7,10,13,21H,8-9,11-12,14H2,1-2H3
InChI key:InChIKey=DADQFHORMDFLTE-UHFFFAOYSA-N
SMILES:C(C1=C(N=C2N1C=CC(C)=C2)C3=CC=C(C)C=C3)N4CCNCC4
Synonyms:
  • Imidazo[1,2-a]pyridine, 7-methyl-2-(4-methylphenyl)-3-(1-piperazinylmethyl)-
  • 7-Methyl-2-(4-methylphenyl)-3-(1-piperazinylmethyl)imidazo[1,2-a]pyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.