CAS 81718-77-6

5-methoxy-3-methyl-1-benzofuran-2-carboxylate

Description:

5-Methoxy-3-methyl-1-benzofuran-2-carboxylate, with the CAS number 81718-77-6, is an organic compound characterized by its benzofuran structure, which consists of a fused benzene and furan ring. This compound features a methoxy group (-OCH3) and a methyl group (-CH3) attached to the benzofuran core, as well as a carboxylate group (-COO-) that contributes to its reactivity and solubility in various solvents. The presence of these functional groups suggests that it may exhibit interesting chemical properties, including potential biological activity. The compound is likely to be a white to off-white solid, and its solubility may vary depending on the solvent used, typically being more soluble in organic solvents than in water. Its molecular structure allows for various synthetic applications, and it may serve as a precursor in the synthesis of more complex molecules or as a potential pharmacophore in medicinal chemistry. As with many organic compounds, safety data should be consulted before handling.

Formula: C₁₁H₉O₄

InChI: InChI=1/C11H10O4/c1-6-8-5-7(14-2)3-4-9(8)15-10(6)11(12)13/h3-5H,1-2H3,(H,12,13)/p-1

SMILES: Cc1c2cc(ccc2oc1C(=O)[O-])OC

5-Methoxy-3-methyl-benzofuran-2-carboxylic acid

CAS: 81718-77-6

Formula: C₁₁H₁₀O₄

Purity: 96%

Color and Shape: Solid

Molecular weight: 206.1947

Ref: IN-DA005J04

5-Methoxy-3-methylbenzofuran-2-carboxylic acid

CAS: 81718-77-6

5-Methoxy-3-methylbenzofuran-2-carboxylic acid

Purity: 96%

Molecular weight: 206.19g/mol

Ref: 54-OR77347

5-Methoxy-3-methylbenzofuran-2-carboxylic acid

CAS: 81718-77-6

Purity: 96%

Molecular weight: 206.1970062

Ref: 10-F603473