CAS 81720-38-9

4-(Pentyloxy)benzenemethanol

Description:

4-(Pentyloxy)benzenemethanol, identified by its CAS number 81720-38-9, is an organic compound characterized by a benzene ring substituted with a pentyloxy group and a hydroxymethyl group. This compound features a hydrophobic pentyloxy chain, which contributes to its solubility properties and potential applications in various fields, including pharmaceuticals and materials science. The presence of the hydroxymethyl group enhances its reactivity, making it a suitable candidate for further chemical modifications. Typically, compounds like this exhibit moderate to low volatility and may have a relatively high boiling point due to the presence of the aromatic system and the alkyl chain. Additionally, the compound's structure suggests potential for hydrogen bonding due to the hydroxyl group, which can influence its physical properties, such as melting point and solubility in polar solvents. Overall, 4-(Pentyloxy)benzenemethanol is of interest for its unique structural features and potential utility in synthetic chemistry and material applications.

Formula: C₁₂H₁₈O₂

InChI: InChI=1S/C12H18O2/c1-2-3-4-9-14-12-7-5-11(10-13)6-8-12/h5-8,13H,2-4,9-10H2,1H3

InChI key: InChIKey=QWOAHKAAZZLJFF-UHFFFAOYSA-N

SMILES: O(CCCCC)C1=CC=C(CO)C=C1

Synonyms:

• 4-Pentyloxybenzyl alcohol
• Benzenemethanol, 4-(pentyloxy)-
• 4-(Pentyloxy)benzenemethanol
• NSC 69114
• [4-(Pentyloxy)phenyl]methanol