CAS 81721-86-0

7-nitro-2H-1,4-benzoxazin-3(4H)-one

Description:

7-Nitro-2H-1,4-benzoxazin-3(4H)-one is a chemical compound characterized by its unique structure, which includes a benzoxazine ring with a nitro group at the 7-position. This compound typically exhibits a yellow crystalline appearance and is soluble in organic solvents. It is known for its role in various chemical reactions, particularly in organic synthesis and as an intermediate in the production of agrochemicals and pharmaceuticals. The presence of the nitro group contributes to its reactivity, making it a useful building block in the synthesis of more complex molecules. Additionally, this compound may exhibit biological activity, which has been the subject of research in fields such as medicinal chemistry. Its stability under standard conditions allows for its use in various applications, although care should be taken due to the potential hazards associated with nitro compounds. Overall, 7-nitro-2H-1,4-benzoxazin-3(4H)-one is a versatile compound with significant implications in both industrial and research settings.

Formula: C₈H₆N₂O₄

InChI: InChI=1/C8H6N2O4/c11-8-4-14-7-3-5(10(12)13)1-2-6(7)9-8/h1-3H,4H2,(H,9,11)

SMILES: c1cc2c(cc1N(=O)=O)OCC(=N2)O

Synonyms:

• 2H-1,4-benzoxazin-3(4H)-one, 7-nitro-
• 7-nitro-2H-benzo[b][1,4]oxazin-3(4H)-one

7-Nitro-2H-benzo[b][1,4]oxazin-3(4H)-one

CAS: 81721-86-0

Formula: C₈H₆N₂O₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 194.1442

Ref: IN-DA005IZT

7-Nitro-2H-1,4-benzoxazin-3(4H)-one

CAS: 81721-86-0

7-Nitro-2H-1,4-benzoxazin-3(4H)-one

Formula: C₈H₆N₂O₄

Purity: ≥95%

Color and Shape: faint yellow to faint beige crystalline needles

Molecular weight: 194.14g/mol

Ref: 54-OR110745

7-Nitro-4H-benzo[1,4]oxazin-3-one

CAS: 81721-86-0

Formula: C₈H₆N₂O₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 194.146

Ref: 10-F060483