CAS 81741-99-3

methyl 4-amino-5-ethylthiophene-3-carboxylate

Description:

Methyl 4-amino-5-ethylthiophene-3-carboxylate is an organic compound characterized by its thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. This compound features an amino group (-NH2) and a carboxylate group (-COOCH3) attached to the thiophene structure, contributing to its reactivity and potential applications in organic synthesis and pharmaceuticals. The ethylthio substituent enhances its solubility and may influence its electronic properties. Methyl 4-amino-5-ethylthiophene-3-carboxylate is typically a solid at room temperature and may exhibit moderate stability under standard conditions. Its functional groups allow for various chemical transformations, making it a valuable intermediate in the synthesis of more complex molecules. Additionally, the presence of the amino group suggests potential for hydrogen bonding, which can affect its physical properties, such as melting point and solubility in different solvents. Overall, this compound is of interest in the fields of medicinal chemistry and materials science due to its unique structural features and potential biological activity.

Formula: C₈H₁₁NO₂S

InChI: InChI=1/C8H11NO2S/c1-3-6-7(9)5(4-12-6)8(10)11-2/h4H,3,9H2,1-2H3

Synonyms:

• Methyl 4-amino-5-ethyl-3-thiophenecarboxylate
• 4-Amino-5-ethyl-3-thiophenecarboxylic acid methyl ester
• 3-Thiophenecarboxylic acid, 4-amino-5-ethyl-, methyl ester

Ro 22-0654

CAS: 81741-99-3

Ro 22-0654, a novel lipid synthesis inhibitor, has antiobesity effects.

Formula: C₈H₁₁NO₂S

Purity: 98%

Color and Shape: Solid

Molecular weight: 185.24

Ref: TM-T28565