CAS 81742-10-1
:4,7-Dichloro-1,3-dihydro-1,3-dioxo-5-isobenzofurancarboxylic acid
Description:
4,7-Dichloro-1,3-dihydro-1,3-dioxo-5-isobenzofurancarboxylic acid, with CAS number 81742-10-1, is a chemical compound characterized by its unique bicyclic structure that incorporates both dioxo and carboxylic acid functional groups. This compound features two chlorine atoms substituted at the 4 and 7 positions of the isobenzofuran ring, which can influence its reactivity and solubility. The presence of the dioxo groups contributes to its potential as a reactive intermediate in various chemical reactions, while the carboxylic acid group may enhance its solubility in polar solvents. The compound is of interest in synthetic organic chemistry and may have applications in pharmaceuticals or agrochemicals due to its structural properties. Its stability, reactivity, and potential biological activity would depend on the specific conditions under which it is used, including pH, temperature, and the presence of other reagents. As with many chlorinated compounds, considerations regarding environmental impact and toxicity are essential in its handling and application.
Formula:C9H2Cl2O5
InChI:InChI=1S/C9H2Cl2O5/c10-3-1-2(7(12)13)6(11)5-4(3)8(14)16-9(5)15/h1H,(H,12,13)
InChI key:InChIKey=OCUQMPDZMXSVFG-UHFFFAOYSA-N
SMILES:ClC1=C2C(=C(Cl)C=C1C(O)=O)C(=O)OC2=O
Synonyms:- 2,5-Dichlorotrimellitic anhydride
- 5-Isobenzofurancarboxylic acid, 4,7-dichloro-1,3-dihydro-1,3-dioxo-
- 4,7-Dichloro-1,3-dihydro-1,3-dioxo-5-isobenzofurancarboxylic acid
- 3,6-Dichlorotrimellitic anhydride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
5-Isobenzofurancarboxylic acid, 4,7-dichloro-1,3-dihydro-1,3-dioxo-
CAS:Formula:C9H2Cl2O5Purity:97%Color and Shape:SolidMolecular weight:261.01524,7-Dichloro-1,3-Dioxo-1,3-Dihydroisobenzofuran-5-Carboxylic Acid
CAS:4,7-Dichloro-1,3-Dioxo-1,3-Dihydroisobenzofuran-5-Carboxylic AcidPurity:97%Molecular weight:261.02g/mol3,6-Dichlorotrimellitic anhydride
CAS:3,6-Dichlorotrimellitic anhydridePurity:≥98%Molecular weight:261.02g/molFluorescein Impurity 2 (3,6-Dichlorotrimellitic Anhydride)
CAS:Formula:C9H2Cl2O5Molecular weight:261.013,6-Dichlorotrimellitic anhydride
CAS:3,6-Dichlorotrimellitic anhydride serves as the essential precursor in the synthesis of various dichlorinated fluoresceins and rhodamines.Formula:C9H2Cl2O5Purity:99.22%Color and Shape:SolidMolecular weight:261.025-Isobenzofurancarboxylic acid, 4,7-dichloro-1,3-dihydro-1,3-dioxo-
CAS:Purity:97%Molecular weight:261.0100098Ref: 10-F863003
50mg38.00€100mg58.00€250mg124.00€500mg223.00€1g290.00€5g835.00€25g1,951.00€100g3,903.00€3,6-Dichloro trimellitic anhydride
CAS:3,6-Dichloro trimellitic anhydride is a reactive compound that is used in the synthesis of fluorescent probes. It is also used as a reagent to introduce chlorine substituents onto organic molecules. Fluorescence measurements can be used to determine the purity of 3,6-dichloro trimellitic anhydride. This compound reacts with nucleic acids, causing them to fluoresce and making them detectable by spectroscopy. 3,6-Dichloro trimellitic anhydride has been used in research involving the study of nucleic acids and their role in DNA replication and repair.Formula:C9H2Cl2O5Purity:Min. 95%Molecular weight:261.01 g/mol





