CymitQuimica logo

CAS 81746-13-6

:

4-(2-phenylethyl)piperazine-1-carboximidamide

Description:
4-(2-phenylethyl)piperazine-1-carboximidamide is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features a phenylethyl group attached to the piperazine, contributing to its potential biological activity. The carboximidamide functional group indicates the presence of a carbon atom double-bonded to a nitrogen atom and single-bonded to another nitrogen atom, which can influence the compound's reactivity and interactions with biological targets. The presence of the phenyl group suggests potential aromatic interactions, which may enhance its binding affinity in biological systems. This compound may exhibit properties relevant to medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that can interact with various biological receptors. Its CAS number, 81746-13-6, allows for easy identification and retrieval of information regarding its properties, synthesis, and applications in scientific literature. Overall, this compound's unique structure positions it as a candidate for further research in drug development and related fields.
Formula:C13H20N4
InChI:InChI=1/C13H20N4/c14-13(15)17-10-8-16(9-11-17)7-6-12-4-2-1-3-5-12/h1-5H,6-11H2,(H3,14,15)
SMILES:c1ccc(cc1)CCN1CCN(CC1)C(=N)N
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.