CymitQuimica logo

CAS 817552-66-2

:

3-methylpentanamidine

Description:
3-Methylpentanamidine, identified by its CAS number 817552-66-2, is an organic compound characterized by its amine functional group and a branched-chain alkane structure. It features a five-carbon backbone with a methyl group attached to the third carbon, contributing to its unique properties. As an amidine, it contains a guanidine-like structure, which can influence its reactivity and interactions with biological systems. The presence of the amine group suggests potential basicity, allowing it to participate in various chemical reactions, including protonation and nucleophilic attacks. This compound may exhibit solubility in polar solvents due to the amine functionality, while its hydrophobic carbon chain can provide some degree of lipophilicity. 3-Methylpentanamidine may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that can mimic biological molecules. However, specific safety and handling information should be consulted, as with any chemical substance, to ensure proper laboratory practices.
Formula:C6H14N2
InChI:InChI=1/C6H14N2/c1-3-5(2)4-6(7)8/h5H,3-4H2,1-2H3,(H3,7,8)
SMILES:CCC(C)CC(=N)N
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.