CAS 817632-37-4

2-[(2-methoxyethyl)carbamoyl]cyclohexanecarboxylic acid

Description:

2-[(2-Methoxyethyl)carbamoyl]cyclohexanecarboxylic acid is a chemical compound characterized by its unique structure, which includes a cyclohexane ring substituted with a carboxylic acid group and a carbamoyl group linked to a 2-methoxyethyl moiety. This compound typically exhibits properties associated with both polar and nonpolar regions due to the presence of the methoxyethyl group and the carboxylic acid functionality, which can engage in hydrogen bonding. It is likely to be soluble in polar solvents, such as water and alcohols, while also having some degree of solubility in organic solvents. The presence of the carbamoyl group suggests potential for biological activity, making it of interest in pharmaceutical research. Additionally, the cyclohexane ring contributes to the compound's conformational flexibility, which can influence its reactivity and interaction with biological targets. Overall, this compound's characteristics make it a subject of interest in medicinal chemistry and related fields.

Formula: C₁₁H₁₉NO₄

InChI: InChI=1/C11H19NO4/c1-16-7-6-12-10(13)8-4-2-3-5-9(8)11(14)15/h8-9H,2-7H2,1H3,(H,12,13)(H,14,15)

SMILES: COCCN=C(C1CCCCC1C(=O)O)O

Synonyms:

• Cyclohexanecarboxylic Acid, 2-[[(2-Methoxyethyl)Amino]Carbonyl]-
• 2-[(2-Methoxyethyl)carbamoyl]cyclohexanecarboxylic acid

2-{[(2-methoxyethyl)amino]carbonyl}cyclohexanecarboxylic acid

CAS: 817632-37-4

Purity: 95.0%

Molecular weight: 229.2760009765625

Ref: 10-F315631