CAS 817638-68-9
:3-azido-7-hydroxy-chromen-2-one
Description:
3-Azido-7-hydroxy-chromen-2-one, with the CAS number 817638-68-9, is a chemical compound that belongs to the class of flavonoids, specifically a derivative of coumarin. This compound features an azido group (-N3) at the 3-position and a hydroxyl group (-OH) at the 7-position of the chromen-2-one structure, which contributes to its unique chemical properties. The presence of the azido group can impart interesting reactivity, making it a potential candidate for various applications in organic synthesis and medicinal chemistry. The hydroxyl group enhances its solubility in polar solvents and may influence its biological activity. This compound may exhibit fluorescence and has potential uses in photochemical studies. Additionally, its structural features suggest that it could interact with biological systems, making it of interest in pharmacological research. However, specific biological activities and safety profiles would require further investigation through empirical studies. Overall, 3-azido-7-hydroxy-chromen-2-one represents a fascinating compound with potential applications in various fields of chemistry and biology.
Formula:C9H5N3O3
InChI:InChI=1/C9H5N3O3/c10-12-11-7-3-5-1-2-6(13)4-8(5)15-9(7)14/h1-4,13H
SMILES:c1cc(cc2c1cc(c(=O)o2)N=[N+]=[NH-])O
Synonyms:- 2H-1-benzopyran-2-one, 3-azido-7-hydroxy-
- 3-Azido-7-hydroxy-2H-chromen-2-one
- 3-Azido-7-Hydroxycoumarin
- Azido-7-hydroxycoumarin, 3-
- 3-Azido-7-hydroxy-chroman-2-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
3-Azido-7-hydroxycoumarin
CAS:Formula:C9H5N3O3Purity:>98.0%(HPLC)Color and Shape:Light yellow to Brown powder to crystalineMolecular weight:203.163-Azido-7-hydroxycoumarin
CAS:Formula:C9H5N3O3Purity:97%Color and Shape:SolidMolecular weight:203.1543Ref: IN-DA0056YH
1gTo inquire5gTo inquire10gTo inquire25gTo inquire50gTo inquire25mg71.00€50mg114.00€100mg157.00€250mg212.00€3-Azido-7-hydroxycoumarin
CAS:3-Azido-7-hydroxycoumarinFormula:C9H5N3O3Purity:97%Color and Shape: orange powderMolecular weight:203.15g/mol3-Azido-7-hydroxycoumarin
CAS:Controlled ProductFormula:C9H5N3O3Color and Shape:NeatMolecular weight:203.153-Azido-7-hydroxycoumarin
CAS:3-Azido-7-hydroxycoumarin is a water soluble coumarin derivative. 3-Azido-7-hydroxycoumarin is able to undergo highly selective and high yielding Cu(I) catalysed cycloaddition reactions with terminal alkynes (Huisgen cycloaddition or “click” chemistry) to afford the corresponding 1,2,3-triazole under relatively mild reaction conditions. The triazoles thus formed, like 7-hydroxycoumarine, are highly fluorescent and, as 3-azido-7-hydroxycoumarin itself does not fluoresce, terminal alkyne containing molecules can be effectively tagged and visualised by fluorescence spectroscopy.
Formula:C9H5N3O3Purity:Min. 98 Area-%Color and Shape:PowderMolecular weight:203.15 g/mol3-Azido-7-hydroxy-2H-chromen-2-one
CAS:Formula:C9H5N3O3Purity:98%Color and Shape:SolidMolecular weight:203.157






