CAS 81777-48-2

2-[(2-amino-6-chloro-9H-purin-9-yl)methoxy]ethyl acetate

Description:

2-[(2-amino-6-chloro-9H-purin-9-yl)methoxy]ethyl acetate, with the CAS number 81777-48-2, is a chemical compound that belongs to the class of purine derivatives. This substance features a purine base structure, which is characterized by a fused double-ring system containing nitrogen atoms. The presence of an amino group and a chloro substituent on the purine ring contributes to its biological activity, potentially influencing its role in biochemical pathways. The methoxy and acetate functional groups enhance its solubility and reactivity, making it suitable for various applications in medicinal chemistry and biochemistry. The compound may exhibit properties such as being a potential inhibitor or modulator of specific enzymes or receptors, which is common among purine derivatives. Its molecular structure suggests it could interact with nucleic acids or proteins, making it of interest in drug development and research related to cellular processes. As with many chemical substances, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₀H₁₂ClN₅O₃

InChI: InChI=1/C10H12ClN5O3/c1-6(17)19-3-2-18-5-16-4-13-7-8(11)14-10(12)15-9(7)16/h4H,2-3,5H2,1H3,(H2,12,14,15)

SMILES: CC(=O)OCCOCn1cnc2c(Cl)[nH]c(=N)nc12

Synonyms:

• ethanol, 2-[(2-amino-6-chloro-9H-purin-9-yl)methoxy]-, acetate (ester)

6-Chloro Acyclovir Acetate

Controlled Product

CAS: 81777-48-2

Applications 6-Chloro Acyclovir Acetate (cas# 81777-48-2) is a compound useful in organic synthesis.

Formula: C₁₀H₁₂ClN₅O₃

Color and Shape: Neat

Molecular weight: 285.69

Ref: TR-C364150

6-Chloro Acyclovir Acetate

CAS: 81777-48-2

Formula: C₁₀H₁₂ClN₅O₃

Molecular weight: 285.69

Ref: ST-EA-CP-A8055