CymitQuimica logo

CAS 81781-90-0

:

8-benzyl-7-(2-chloroethyl)-1,3-dimethyl-3,7-dihydro-1H-purine-2,6-dione

Description:
8-Benzyl-7-(2-chloroethyl)-1,3-dimethyl-3,7-dihydro-1H-purine-2,6-dione, with the CAS number 81781-90-0, is a synthetic compound that belongs to the purine class of molecules. This substance features a purine core, which is characterized by a fused double-ring structure containing nitrogen atoms. The presence of a benzyl group and a chloroethyl substituent contributes to its unique chemical properties and potential biological activity. The dimethyl groups at positions 1 and 3 of the purine ring enhance its lipophilicity, potentially influencing its interaction with biological membranes and receptors. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of therapeutic agents. Its specific characteristics, such as solubility, stability, and reactivity, would depend on the conditions of use and the presence of other functional groups. As with many synthetic compounds, safety and handling precautions are essential due to potential toxicity or reactivity.
Formula:C16H17ClN4O2
InChI:InChI=1/C16H17ClN4O2/c1-19-14-13(15(22)20(2)16(19)23)21(9-8-17)12(18-14)10-11-6-4-3-5-7-11/h3-7H,8-10H2,1-2H3
SMILES:Cn1c2c(c(=O)n(C)c1=O)n(CCCl)c(Cc1ccccc1)n2
Synonyms:
  • 1H-Purine-2,6-dione, 7-(2-chloroethyl)-3,7-dihydro-1,3-dimethyl-8-(phenylmethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.