CAS 81801-12-9
:Xamoterol
Description:
Xamoterol is a selective beta-1 adrenergic agonist primarily used in the treatment of heart failure and certain types of cardiac dysfunction. It is characterized by its ability to stimulate beta-1 adrenergic receptors, leading to increased heart contractility and improved cardiac output without significantly affecting heart rate, which distinguishes it from non-selective beta agonists. Xamoterol exhibits a favorable pharmacological profile, as it can enhance myocardial performance while minimizing the risk of arrhythmias commonly associated with other beta-agonists. The compound is typically administered orally and has a relatively short half-life, necessitating multiple doses throughout the day for sustained therapeutic effects. Its chemical structure includes a phenolic moiety, contributing to its activity at the adrenergic receptors. As with any medication, potential side effects may include palpitations, headache, or gastrointestinal disturbances, and its use should be carefully monitored in patients with pre-existing cardiovascular conditions. Overall, xamoterol represents a targeted approach in managing heart failure, emphasizing the importance of receptor selectivity in pharmacotherapy.
Formula:C16H25N3O5
InChI:InChI=1S/C16H25N3O5/c20-13-1-3-15(4-2-13)24-12-14(21)11-17-5-6-18-16(22)19-7-9-23-10-8-19/h1-4,14,17,20-21H,5-12H2,(H,18,22)
InChI key:InChIKey=DXPOSRCHIDYWHW-UHFFFAOYSA-N
SMILES:C(NCCNCC(COC1=CC=C(O)C=C1)O)(=O)N2CCOCC2
Synonyms:- (+-)-N-(2-((2-Hydroxy-3-(p-hydroxyphenoxy)propyl)amino)ethyl)-4-morpholinecarboxamide
- 4-Morpholinecarboxamide, N-(2-((2-hydroxy-3-(4-hydroxyphenoxy)propyl)amino)ethyl)-, (+-)-
- N-(2-{[2-hydroxy-3-(4-hydroxyphenoxy)propyl]amino}ethyl)morpholine-4-carboxamide
- N-[2-[[2-Hydroxy-3-(4-hydroxyphenoxy)propyl]amino]ethyl]-4-morpholinecarboxamide
- Unii-7He0Jql703
- Xamoterol [USAN:INN:BAN]
- Xamoterolum
- Xamoterolum [Latin]
- Xamoterol
- Xamoterol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Xamoterol
CAS:<p>Xamoterol is a cardiac stimulant.</p>Formula:C16H25N3O5Color and Shape:SolidMolecular weight:339.39

