CAS 81806-47-5

1,2-Pyrrolidinedicarboxylic acid, 4-hydroxy-, 1-(phenylmethyl) ester, (2S-cis)-, compd. with N-cyclohexylcyclohexanamine (1:1)

Description:

1,2-Pyrrolidinedicarboxylic acid, 4-hydroxy-, 1-(phenylmethyl) ester, (2S-cis)-, compd. with N-cyclohexylcyclohexanamine (1:1) is a complex organic compound characterized by its unique structural features, including a pyrrolidine ring and multiple functional groups such as carboxylic acids and esters. The presence of the phenylmethyl group contributes to its aromatic characteristics, while the cyclohexylcyclohexanamine component adds to its amine functionality. This compound likely exhibits properties typical of esters and amines, including potential solubility in organic solvents and varying degrees of reactivity depending on the functional groups present. Its stereochemistry, indicated by the (2S-cis) designation, suggests specific spatial arrangements that may influence its biological activity and interactions. The compound may be of interest in pharmaceutical applications, particularly in drug design, due to its potential to interact with biological targets. However, detailed studies would be necessary to fully elucidate its properties, including stability, reactivity, and biological effects.

Formula: C₁₃H₁₅NO₅·C₁₂H₂₃N

InChI: InChI=1S/C13H15NO5.C12H23N/c15-10-6-11(12(16)17)14(7-10)13(18)19-8-9-4-2-1-3-5-9;1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h1-5,10-11,15H,6-8H2,(H,16,17);11-13H,1-10H2/t10-,11-;/m0./s1

InChI key: InChIKey=JDCOIVWZVLTVNM-ACMTZBLWSA-N

SMILES: C(OCC1=CC=CC=C1)(=O)N2[C@H](C(O)=O)C[C@H](O)C2.N(C1CCCCC1)C2CCCCC2

Synonyms:

• 1,2-Pyrrolidinedicarboxylic acid, 4-hydroxy-, 1-(phenylmethyl) ester, (2S-cis)-, compd. with N-cyclohexylcyclohexanamine (1:1)