CAS 81820-65-7

4-Phenylthieno[3,2-c]pyridine

Description:

4-Phenylthieno[3,2-c]pyridine is a heterocyclic organic compound characterized by its unique fused ring structure, which includes a thieno and pyridine moiety along with a phenyl group. This compound typically exhibits properties associated with both aromatic and heteroaromatic compounds, such as stability and potential for diverse chemical reactivity. It is often studied for its biological activity, particularly in the context of medicinal chemistry, where it may exhibit pharmacological properties. The presence of the thieno and pyridine rings can influence its electronic properties, making it a candidate for applications in organic electronics and as a ligand in coordination chemistry. Additionally, its solubility and stability can vary depending on the solvent and environmental conditions. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards. Overall, 4-Phenylthieno[3,2-c]pyridine represents a class of compounds with significant interest in both synthetic and applied chemistry.

Formula: C₁₃H₉NS

InChI: InChI=1/C13H9NS/c1-2-4-10(5-3-1)13-11-7-9-15-12(11)6-8-14-13/h1-9H

SMILES: c1ccc(cc1)c1c2ccsc2ccn1