CAS 81824-11-5
:(11S,12S)-11,12-dihydrobenzo[e]acephenanthrylene-11,12-diol
Description:
(11S,12S)-11,12-dihydrobenzo[e]acephenanthrylene-11,12-diol, with the CAS number 81824-11-5, is a polycyclic aromatic compound characterized by its complex fused ring structure. This substance features two hydroxyl (-OH) groups located at the 11 and 12 positions of the molecule, which significantly influence its chemical reactivity and solubility. The presence of these hydroxyl groups enhances its potential for hydrogen bonding, making it more polar compared to its non-hydroxylated counterparts. This compound is of interest in various fields, including organic chemistry and materials science, due to its unique structural properties and potential applications in organic electronics and as a precursor in synthetic organic chemistry. Its stereochemistry, indicated by the (11S,12S) configuration, suggests specific spatial arrangements that can affect its biological activity and interactions with other molecules. Overall, this compound exemplifies the intricate relationship between molecular structure and chemical behavior, making it a subject of study for researchers exploring advanced materials and organic synthesis.
Formula:C20H14O2
InChI:InChI=1/C20H14O2/c21-17-9-8-11-10-16-13-5-2-1-4-12(13)14-6-3-7-15(19(14)16)18(11)20(17)22/h1-10,17,20-22H/t17-,20+/m0/s1
Synonyms:- Benz(e)acephenanthrylene-11,12-diol, 11,12-dihydro-, trans-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
trans-11,12-Dihydro-11,12-dihydroxybenzo[b]fluoranthene
CAS:Controlled ProductFormula:C20H14O2Color and Shape:NeatMolecular weight:286.324
