CAS 81827-74-9

Neotriptophenolide

Description:

Neotriptophenolide, with the CAS number 81827-74-9, is a chemical compound that belongs to the class of phenolic compounds. It is characterized by its complex molecular structure, which typically includes multiple aromatic rings and hydroxyl groups, contributing to its potential biological activity. Neotriptophenolide is known for its role in various biochemical processes and may exhibit antioxidant properties, making it of interest in pharmacological research. The compound's solubility, stability, and reactivity can vary depending on environmental conditions such as pH and temperature. Additionally, its interactions with other biological molecules can influence its efficacy and application in medicinal chemistry. While specific applications may vary, compounds like Neotriptophenolide are often explored for their potential therapeutic benefits, including anti-inflammatory and antimicrobial effects. Further studies are necessary to fully elucidate its mechanisms of action and potential uses in various fields, including pharmaceuticals and natural product chemistry.

Formula: C₂₁H₂₆O₄

InChI: InChI=1S/C21H26O4/c1-11(2)14-9-17(22)18-13(19(14)24-4)5-6-16-15-10-25-20(23)12(15)7-8-21(16,18)3/h9,11,16,22H,5-8,10H2,1-4H3/t16-,21-/m0/s1

InChI key: InChIKey=YQHBJMHUMJXFDN-KKSFZXQISA-N

SMILES: C[C@@]12C=3C(=C(OC)C(C(C)C)=CC3O)CC[C@]1(C4=C(CC2)C(=O)OC4)[H]

Synonyms:

• Phenanthro[1,2-c]furan-1(3H)-one, 3b,4,5,9b,10,11-hexahydro-9-hydroxy-6-methoxy-9b-methyl-7-(1-methylethyl)-, (3bR,9bS)-
• Neotriptophenolide
• (3bR,9bS)-3b,4,5,9b,10,11-Hexahydro-9-hydroxy-6-methoxy-9b-methyl-7-(1-methylethyl)phenanthro[1,2-c]furan-1(3H)-one
• Phenanthro[1,2-c]furan-1(3H)-one, 3b,4,5,9b,10,11-hexahydro-9-hydroxy-6-methoxy-9b-methyl-7-(1-methylethyl)-, (3bR-trans)-

Neotriptophenolide

CAS: 81827-74-9

Neotriptophenolide

Purity: ≥98%

Molecular weight: 342.43g/mol

Ref: 54-BUP00537

Neotriptophenolide

CAS: 81827-74-9

Formula: C₂₁H₂₆O₄

Molecular weight: 342.44

Ref: 7W-GY5248

Neotriptophenolide

CAS: 81827-74-9

Formula: C₂₁H₂₆O₄

Purity: 95%~99%

Molecular weight: 342.435

Ref: BP-BP4424

Neotriptophenolide

CAS: 81827-74-9

Neotriptophenolide is a natural product

Formula: C₂₁H₂₆O₄

Purity: 99.46%

Color and Shape: Solid

Molecular weight: 342.43

Ref: TM-TN1987

Neotriptophenolide

CAS: 81827-74-9

Neotriptophenolide is a synthetic compound that belongs to the class of bioactive alkaloids. It is derived from a rational synthesis process, leveraging advanced organic chemistry techniques to replicate and improve upon naturally occurring compounds. The mode of action of Neotriptophenolide involves specific interactions with cellular receptors and enzymes, influencing various biochemical pathways essential for cellular regulation and signaling.

Purity: Min. 95%

Ref: 3D-FN145256