CymitQuimica logo

CAS 81831-69-8

:

2-(Chloromethyl)-6-methylpyrazine

Description:
2-(Chloromethyl)-6-methylpyrazine is an organic compound characterized by its pyrazine ring, which is a six-membered aromatic heterocycle containing two nitrogen atoms. This compound features a chloromethyl group (-CH2Cl) at the 2-position and a methyl group (-CH3) at the 6-position of the pyrazine ring, contributing to its reactivity and potential applications in organic synthesis. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the chloromethyl group makes it a useful intermediate in the synthesis of various pharmaceuticals and agrochemicals, as it can participate in nucleophilic substitution reactions. Additionally, the methyl group can influence the compound's solubility and volatility. 2-(Chloromethyl)-6-methylpyrazine is also of interest in the field of flavor and fragrance chemistry due to its potential aromatic properties. As with many chlorinated compounds, it should be handled with care, considering its reactivity and potential health hazards.
Formula:C6H7ClN2
InChI:InChI=1S/C6H7ClN2/c1-5-3-8-4-6(2-7)9-5/h3-4H,2H2,1H3
InChI key:InChIKey=OKRBGEYTNRBJDM-UHFFFAOYSA-N
SMILES:C(Cl)C1=NC(C)=CN=C1
Synonyms:
  • 2-(Chloromethyl)-6-methylpyrazine
  • Pyrazine, 2-(chloromethyl)-6-methyl-
  • Chloromethyl)-6-methylpyrazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.