CAS 81851-47-0
:7-amino-3-methyl-1,2-benzoxazol-6-ol
Description:
7-Amino-3-methyl-1,2-benzoxazol-6-ol, with the CAS number 81851-47-0, is a chemical compound characterized by its unique structure that includes a benzoxazole ring, an amino group, and a hydroxyl group. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar solvents due to the presence of the hydroxyl group. The amino group can participate in hydrogen bonding, which may influence its reactivity and interactions with other molecules. It is often studied for its biological activity, particularly in the context of medicinal chemistry, where derivatives of benzoxazole compounds have shown potential as pharmaceuticals. The compound may also exhibit fluorescence properties, making it useful in various analytical applications. Its stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in both laboratory and industrial settings. Overall, 7-amino-3-methyl-1,2-benzoxazol-6-ol is a compound of interest in both research and application due to its diverse chemical properties.
Formula:C8H8N2O2
InChI:InChI=1/C8H8N2O2/c1-4-5-2-3-6(11)7(9)8(5)12-10-4/h2-3,11H,9H2,1H3
Synonyms:- 7-Amino-3-methyl-1,2-benzoxazol-6-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.