CAS 81861-15-6
:10,11-Dihydro-2,10,11-trihydroxy-5H-dibenz[b,f]azepine-5-carboxamide
Description:
10,11-Dihydro-2,10,11-trihydroxy-5H-dibenz[b,f]azepine-5-carboxamide, with CAS number 81861-15-6, is a chemical compound that belongs to the dibenzazepine class of compounds. It features a complex polycyclic structure characterized by a dibenzazepine core, which is a fused bicyclic system containing nitrogen. The presence of multiple hydroxyl (-OH) groups indicates that it has significant potential for hydrogen bonding, which can influence its solubility and reactivity. The carboxamide functional group (-C(=O)NH2) suggests that it may exhibit biological activity, potentially interacting with various biological targets. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could confer specific pharmacological properties. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its properties would be assessed through various analytical methods, including spectroscopy and chromatography. As with any chemical substance, safety and handling precautions should be observed, particularly in laboratory settings.
Formula:C15H14N2O4
InChI:InChI=1S/C15H14N2O4/c16-15(21)17-11-4-2-1-3-9(11)13(19)14(20)10-7-8(18)5-6-12(10)17/h1-7,13-14,18-20H,(H2,16,21)
InChI key:InChIKey=CZWHEHQRNHJDCR-UHFFFAOYSA-N
SMILES:C(N)(=O)N1C=2C(C(O)C(O)C=3C1=CC=CC3)=CC(O)=CC2
Synonyms:- 2,10,11-Trihydroxy-10,11-dihydrocarbamazepine
- 5H-Dibenz[b,f]azepine-5-carboxamide, 10,11-dihydro-2,10,11-trihydroxy-
- 10,11-Dihydro-2,10,11-trihydroxy-5H-dibenz[b,f]azepine-5-carboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
