
CAS 81861-72-5
:(5R,6S)-3-(β-D-Glucopyranosyloxy)-1,2,3,6-tetrahydro-2-hydroxy-4-methoxy-1-methyl-6-oxo-3-pyridinecarbonitrile
Description:
The chemical substance with the name "(5R,6S)-3-(β-D-Glucopyranosyloxy)-1,2,3,6-tetrahydro-2-hydroxy-4-methoxy-1-methyl-6-oxo-3-pyridinecarbonitrile" and CAS number "81861-72-5" is a complex organic compound characterized by its unique structural features. It contains a pyridine ring, which is a six-membered aromatic ring with one nitrogen atom, contributing to its potential biological activity. The presence of a glucopyranosyl moiety indicates that it is a glycoside, which may enhance its solubility and bioavailability. The tetrahydro structure suggests that it is a saturated derivative, which can influence its reactivity and stability. Additionally, the presence of functional groups such as hydroxyl, methoxy, and cyano groups suggests potential for hydrogen bonding and reactivity in various chemical environments. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug development. Its specific stereochemistry, indicated by the (5R,6S) configuration, may also play a crucial role in its biological interactions and efficacy.
Formula:C14H20N2O9
InChI:InChI=1S/C14H20N2O9/c1-16-8(18)3-7(23-2)14(5-15,13(16)22)25-12-11(21)10(20)9(19)6(4-17)24-12/h3,6,9-13,17,19-22H,4H2,1-2H3/t6-,9-,10+,11-,12+,13+,14-/m1/s1
InChI key:InChIKey=QZRKNNXRNBTODR-JKTRLFLGSA-N
SMILES:O([C@]1(C#N)C(OC)=CC(=O)N(C)[C@H]1O)[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O
Synonyms:- Acalyphin
- (5R,6S)-3-(β-D-Glucopyranosyloxy)-1,2,3,6-tetrahydro-2-hydroxy-4-methoxy-1-methyl-6-oxo-3-pyridinecarbonitrile
- 3-Pyridinecarbonitrile, 3-(β-D-glucopyranosyloxy)-1,2,3,6-tetrahydro-2-hydroxy-4-methoxy-1-methyl-6-oxo-, (5R,6S)-
- NSC 378984
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Acalyphin
CAS:Acalyphin is a cyanopyridine glycoside derived from Acalypha indica (Euphorbiaceae).Formula:C14H20N2O9Color and Shape:SolidMolecular weight:360.319
