CAS 81863-45-8

3-amino-4-methylbenzyl alcohol

Description:

3-Amino-4-methylbenzyl alcohol, with the CAS number 81863-45-8, is an organic compound characterized by the presence of an amino group (-NH2) and a hydroxyl group (-OH) attached to a benzene ring that also features a methyl group (-CH3). This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in polar solvents such as water and alcohols due to the presence of the hydroxyl group, which can engage in hydrogen bonding. The amino group contributes to its basicity and potential reactivity in various chemical reactions, including nucleophilic substitutions and coupling reactions. 3-Amino-4-methylbenzyl alcohol may be utilized in the synthesis of pharmaceuticals, agrochemicals, and as an intermediate in organic synthesis. Its properties, such as melting point, boiling point, and specific reactivity, can vary based on the conditions and the presence of other functional groups in a reaction mixture. Safety data should be consulted for handling and storage, as with all chemical substances.

Formula: C₈H₁₁NO

InChI: InChI=1/C8H11NO/c1-6-2-3-7(5-10)4-8(6)9/h2-4,10H,5,9H2,1H3

SMILES: Cc1ccc(cc1N)CO

Synonyms:

• (3-Amino-4-Methylphenyl)Methanol

3-Amino-4-methylbenzyl Alcohol

CAS: 81863-45-8

Formula: C₈H₁₁NO

Purity: >98.0%(GC)(T)

Color and Shape: White to Light yellow to Light orange powder to crystal

Molecular weight: 137.18

Ref: 3B-A2998

Benzenemethanol, 3-​amino-​4-​methyl-

CAS: 81863-45-8

Formula: C₈H₁₁NO

Purity: 99%

Color and Shape: Solid

Molecular weight: 137.1790

Ref: IN-DA003IVW

3-Amino-4-Methylbenzyl Alcohol

CAS: 81863-45-8

3-Amino-4-Methylbenzyl Alcohol

Purity: 99%

Molecular weight: 137.18g/mol

Ref: 54-OR1010889

3-Amino-4-methylbenzyl alcohol

CAS: 81863-45-8

Formula: C₈H₁₁NO

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 137.182

Ref: 10-F047882