CAS 81864-15-5
:1,3-Benzodioxole-5,6-diamine, hydrochloride (1:2)
Description:
1,3-Benzodioxole-5,6-diamine, hydrochloride (1:2) is a chemical compound characterized by its unique bicyclic structure, which includes a benzodioxole moiety and two amine functional groups. This compound is typically encountered as a hydrochloride salt, enhancing its solubility in water and making it suitable for various applications in research and pharmaceuticals. The presence of the amine groups suggests potential reactivity, allowing for participation in various chemical reactions, such as acylation or alkylation. Its molecular structure may contribute to biological activity, making it of interest in medicinal chemistry. The compound is often studied for its potential roles in drug development, particularly in the context of targeting specific biological pathways. Safety data indicates that, like many amines, it should be handled with care, as it may pose risks if ingested or inhaled. Overall, 1,3-Benzodioxole-5,6-diamine, hydrochloride is a versatile compound with significant implications in both synthetic and medicinal chemistry.
Formula:C7H8N2O2·2ClH
InChI:InChI=1S/C7H8N2O2.2ClH/c8-4-1-6-7(2-5(4)9)11-3-10-6;;/h1-2H,3,8-9H2;2*1H
InChI key:InChIKey=YXEJRYIEFFUUID-UHFFFAOYSA-N
SMILES:NC=1C=C2C(=CC1N)OCO2.Cl
Synonyms:- 1,2-Diamino-4,5-Methylenedioxybenzene*Dihydrochlo
- 1,2-Diamino-4,5-methylenedioxybenzene dihydrochloride
- 1,3-Benzodioxole-5,6-Diamine Dihydrochloride
- 1,3-Benzodioxole-5,6-diamine hydrochloride (1:2)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Benzo[d][1,3]dioxole-5,6-diamine dihydrochloride
CAS:Formula:C7H10Cl2N2O2Purity:95%Color and Shape:SolidMolecular weight:225.07251,3-Benzodioxole-5,6-diamine dihydrochloride
CAS:1,3-Benzodioxole-5,6-diamine dihydrochlorideFormula:C7H8N2O2·2ClHPurity:≥95%Color and Shape: light red powderMolecular weight:225.07g/mol4,5-Methylenedioxy-1,2-phenylenediamine dihydrochloride
CAS:Formula:C7H8N2O2·2HClPurity:≥ 90.0%Color and Shape:Off-white to brown/red/grey powder or crystalsMolecular weight:225.071,2-Diamino-4,5-methylenedioxybenzene, Dihydrochloride
CAS:Controlled ProductStability Light Sensitive
Applications A highly sensitive reagent for α-keto acids. A fluorometric labeling reagent. Dyes and metabolites.
References Kajihara, Y., et al.: Carb. Res., 331, 455 (2001)Formula:C7H8N2O2·2ClHColor and Shape:NeatMolecular weight:225.071,2-Diamino-4,5-methylenedioxybenzene dihydrochloride
CAS:1,2-Diamino-4,5-methylenedioxybenzene dihydrochloride, also known as DMB dihydrochloride, is a building block used in organic chemistry. DMB dihydrochloride is the bis HCl salt of a 1,3-benzodioxole ring with amino groups in the 4 and 5 positions.
Formula:C7H10Cl2N2O2Purity:Min. 90 Area-%Color and Shape:Beige PowderMolecular weight:225.07 g/mol





