CAS 81882-12-4
:1-(2-thienylmethyl)guanidine
Description:
1-(2-Thienylmethyl)guanidine is an organic compound characterized by the presence of a guanidine functional group attached to a thienylmethyl moiety. The thienyl group, derived from thiophene, contributes to the compound's aromatic properties and potential reactivity. This compound typically exhibits a white to off-white crystalline appearance and is soluble in polar solvents, which is common for guanidine derivatives. Its structure allows for hydrogen bonding, which can influence its solubility and interaction with biological systems. The guanidine group is known for its basicity and ability to act as a nucleophile, making this compound of interest in medicinal chemistry and potential pharmaceutical applications. Additionally, the presence of the thienyl ring may impart unique electronic properties, enhancing its potential as a ligand in coordination chemistry or as a building block in organic synthesis. Overall, 1-(2-thienylmethyl)guanidine is a versatile compound with implications in various chemical and biological contexts.
Formula:C6H9N3S
InChI:InChI=1/C6H9N3S/c7-6(8)9-4-5-2-1-3-10-5/h1-3H,4H2,(H4,7,8,9)
Synonyms:- guanidine, N-(2-thienylmethyl)-
- 1-(thiophen-2-ylmethyl)guanidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
