CymitQuimica logo

CAS 819-60-3

:

1-(2,2,2-trifluoroethyl)urea

Description:
1-(2,2,2-Trifluoroethyl)urea, with the CAS number 819-60-3, is an organic compound characterized by the presence of a urea functional group and a trifluoroethyl substituent. This compound typically appears as a white crystalline solid and is known for its high thermal stability and solubility in polar solvents. The trifluoroethyl group imparts unique properties, such as increased lipophilicity and altered hydrogen bonding capabilities, which can influence its reactivity and interactions with biological systems. It is often utilized in various chemical syntheses and research applications, particularly in the fields of medicinal chemistry and agrochemicals. The presence of fluorine atoms enhances its metabolic stability, making it an interesting candidate for drug design. However, handling this compound requires caution due to the potential toxicity associated with fluorinated compounds. Overall, 1-(2,2,2-trifluoroethyl)urea serves as a valuable building block in organic synthesis and contributes to the development of novel chemical entities.
Formula:C3H5F3N2O
InChI:InChI=1/C3H5F3N2O/c4-3(5,6)1-8-2(7)9/h1H2,(H3,7,8,9)
SMILES:C(C(F)(F)F)NC(=N)O
Synonyms:
  • N-(2,2,2-trifluoroethyl)urea
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.