CymitQuimica logo

CAS 819-62-5

:

4-(Difluoromethylsilyl)butanenitrile

Description:
4-(Difluoromethylsilyl)butanenitrile, with the CAS number 819-62-5, is an organosilicon compound characterized by the presence of a difluoromethylsilyl group attached to a butanenitrile backbone. This compound features a four-carbon chain with a nitrile functional group (-C≡N) at one end, which contributes to its reactivity and potential applications in organic synthesis and materials science. The difluoromethylsilyl group enhances the compound's properties, such as volatility and solubility, while also influencing its electronic characteristics. Typically, compounds like this may exhibit unique behavior in chemical reactions due to the presence of both silicon and fluorine atoms, which can affect their stability and reactivity. Additionally, the presence of the nitrile group can impart polar characteristics, making the compound useful in various chemical processes. Overall, 4-(Difluoromethylsilyl)butanenitrile is of interest in fields such as pharmaceuticals, agrochemicals, and materials development due to its distinctive structural features and potential utility.
Formula:C5H9F2NSi
InChI:InChI=1S/C5H9F2NSi/c1-9(6,7)5-3-2-4-8/h2-3,5H2,1H3
InChI key:InChIKey=LDTAYEQFIXAVET-UHFFFAOYSA-N
SMILES:C([Si](C)(F)F)CCC#N
Synonyms:
  • 3-Cyanopropylmethyldifluorosilane
  • Butanenitrile, 4-(difluoromethylsilyl)-
  • 4-(Difluoromethylsilyl)butanenitrile
  • Butyronitrile, 4-(difluoromethylsilyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.