CAS 81902-33-2
:3,3',4,5,5'-pentabromobiphenyl
Description:
3,3',4,5,5'-pentabromobiphenyl is a polybrominated biphenyl (PBB) compound characterized by the presence of five bromine atoms attached to a biphenyl structure. This compound is part of a larger class of brominated flame retardants, which are used to reduce flammability in various materials. Its molecular structure consists of two phenyl rings connected by a single bond, with bromine substituents located at the 3, 3', 4, 5, and 5' positions. The presence of multiple bromine atoms significantly alters its physical and chemical properties, including increased hydrophobicity and thermal stability. 3,3',4,5,5'-pentabromobiphenyl is known for its persistence in the environment and potential bioaccumulation in living organisms, raising concerns regarding its ecological and health impacts. Regulatory measures have been implemented in various regions to limit the use of such compounds due to their toxicological profiles. Overall, while effective as a flame retardant, the environmental and health implications of 3,3',4,5,5'-pentabromobiphenyl necessitate careful consideration and management.
Formula:C12H5Br5
InChI:InChI=1/C12H5Br5/c13-8-1-6(2-9(14)5-8)7-3-10(15)12(17)11(16)4-7/h1-5H
Synonyms:- 1,1'-Biphenyl, 3,3',4,5,5'-pentabromo-
- 3,3',4,5,5'-Pentabromo-1,1'-biphenyl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
