
CAS 819056-77-4
:N-(5-Fluoro-2-methylphenyl)-N′-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea
Description:
N-(5-Fluoro-2-methylphenyl)-N′-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea, with CAS number 819056-77-4, is a chemical compound characterized by its urea functional group, which is linked to two distinct aromatic moieties. One of these moieties contains a fluorine substituent, enhancing its potential for biological activity, while the other features a boron-containing dioxaborolane group, which is often utilized in medicinal chemistry for its ability to form stable complexes and facilitate various chemical reactions. The presence of the tetramethyl dioxaborolane moiety suggests potential applications in drug development, particularly in targeting specific biological pathways or enhancing the solubility and stability of pharmaceutical agents. This compound may exhibit unique properties such as selective reactivity and improved pharmacokinetics due to its structural features. Overall, its design reflects a strategic approach to optimizing interactions within biological systems, making it a subject of interest in research and development within the fields of medicinal and organic chemistry.
Formula:C20H24BFN2O3
InChI:InChI=1S/C20H24BFN2O3/c1-13-6-9-15(22)12-17(13)24-18(25)23-16-10-7-14(8-11-16)21-26-19(2,3)20(4,5)27-21/h6-12H,1-5H3,(H2,23,24,25)
InChI key:InChIKey=PITFVGOEBSCDAQ-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C2=CC=C(NC(NC3=C(C)C=CC(F)=C3)=O)C=C2
Synonyms:- N-(5-Fluoro-2-methylphenyl)-N′-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea
- 1-(5-fluoro-2-methylphenyl)-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea
- Urea, N-(5-fluoro-2-methylphenyl)-N′-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Urea, N-(5-fluoro-2-methylphenyl)-N′-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-
CAS:Formula:C20H24BFN2O3Molecular weight:370.2256
