CAS 81907-61-1
:Ganoderic acid B
Description:
Ganoderic acid B is a triterpenoid compound primarily derived from the Ganoderma lucidum mushroom, commonly known as reishi or lingzhi. This compound is characterized by its complex molecular structure, which includes multiple rings and functional groups, contributing to its bioactivity. Ganoderic acid B exhibits various pharmacological properties, including anti-inflammatory, antioxidant, and potential anticancer effects, making it of interest in medicinal chemistry and natural product research. It is typically found in the fruiting bodies and mycelium of the Ganoderma species and is often studied for its role in traditional medicine and potential therapeutic applications. The compound is soluble in organic solvents but has limited solubility in water, which can influence its bioavailability and efficacy in biological systems. Research continues to explore its mechanisms of action and potential health benefits, highlighting the importance of natural compounds in drug discovery and development.
Formula:C30H44O7
InChI:InChI=1S/C30H44O7/c1-15(10-17(31)11-16(2)26(36)37)18-12-23(35)30(7)25-19(32)13-21-27(3,4)22(34)8-9-28(21,5)24(25)20(33)14-29(18,30)6/h15-16,18-19,21-22,32,34H,8-14H2,1-7H3,(H,36,37)/t15-,16-,18-,19+,21+,22+,28+,29-,30+/m1/s1
InChI key:InChIKey=LWPLEHFGBRFRKI-NBCWKOIPSA-N
SMILES:C[C@]12C3=C([C@]4(C)[C@@](C[C@@H]3O)(C(C)(C)[C@@H](O)CC4)[H])C(=O)C[C@]1(C)[C@@]([C@@H](CC(C[C@H](C(O)=O)C)=O)C)(CC2=O)[H]
Synonyms:- (3β,7β,25R)-3,7-Dihydroxy-11,15,23-trioxolanost-8-en-26-oic acid
- Lanost-8-en-26-oic acid, 3,7-dihydroxy-11,15,23-trioxo-, (3β,7β,25R)-
- Ganoderic acid B
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
(2R,6R)-6-((3S,5R,7S,10S,13R,14R,17R)-3,7-Dihydroxy-4,4,10,13,14-pentamethyl-11,15-dioxo-2,3,4,5,6,7,10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)-2-methyl-4-oxoheptanoic acid
CAS:Formula:C30H44O7Purity:97%Color and Shape:SolidMolecular weight:516.6662Ganoderic Acid B
CAS:Oxidization and hydroxylation are the common metabolic pathways for Ganoderic acid B.Formula:C30H44O7Purity:95%~99%Color and Shape:PowderMolecular weight:516.675Ganoderic acid B
CAS:Ganoderic acid B: quality marker for G. lucidum products, inhibits telomerase & EBV activation, moderates HIV-1 protease.Formula:C30H44O7Purity:99.09% - 99.97%Color and Shape:SolidMolecular weight:516.67Ganoderic acid b
CAS:Carboxylic acid with additional oxygen functionsFormula:C30H44O7Purity:≥ 95.0 % (HPLC)Molecular weight:516.67Ganoderic Acid B
CAS:Applications Ganoderic Acid B, is a new lanostanoid triterpene extracted from the fruit bodies of Ganoderma Lucidum mushroom. these compounds are shown to possess many therapeutic properties. They can be used as anti-virus, anti-inflammation, anti-tumor, immunity-promoting, anti-diabetic, etc.
References Shu-Hong, G., et al.: J. Asia. Natur. Pro. Res., 10, 695 (2008);Formula:C30H44O7Color and Shape:Off White PowderMolecular weight:516.67Ganoderic acid B
CAS:Controlled ProductGanoderic acid B is a fatty acid that can be extracted from the mushroom Ganoderma lucidum. It has been shown to inhibit acetylcholinesterase and butyrylcholinesterase, which are enzymes involved in neurotransmission. This compound also inhibits the production of nitric oxide, prostaglandins, and leukotrienes by inhibiting the activation of phospholipases A2 and cyclooxygenases. In addition, it has been shown to have anti-inflammatory effects and may be used for the treatment of symptoms such as dry eye syndrome, lacrimal gland inflammation, or chronic asthma. Ganoderic acid B can be found in some dietary supplements or food products as an ingredient.Formula:C30H44O7Purity:Min. 95%Color and Shape:White PowderMolecular weight:516.67 g/mol







