CAS 81932-04-9

1-(Bromodifluoromethoxy)-4-nitrobenzene

Description:

1-(Bromodifluoromethoxy)-4-nitrobenzene, with the CAS number 81932-04-9, is an organic compound characterized by its unique functional groups and molecular structure. It features a nitro group (-NO2) attached to a benzene ring, which is also substituted with a bromodifluoromethoxy group. This compound is likely to exhibit significant polarity due to the presence of electronegative atoms such as bromine and fluorine, which can influence its reactivity and solubility in various solvents. The bromodifluoromethoxy group may impart specific electronic properties, making it useful in various chemical reactions, including nucleophilic substitutions or as a potential intermediate in synthetic organic chemistry. Additionally, the nitro group can enhance the compound's reactivity, making it a candidate for further functionalization. Safety and handling precautions should be observed, as compounds containing halogens and nitro groups can pose health and environmental risks. Overall, 1-(Bromodifluoromethoxy)-4-nitrobenzene is a compound of interest in both academic and industrial chemistry contexts.

Formula: C₇H₄BrF₂NO₃

InChI: InChI=1S/C7H4BrF2NO3/c8-7(9,10)14-6-3-1-5(2-4-6)11(12)13/h1-4H

InChI key: InChIKey=JPNHCEIQOASHOX-UHFFFAOYSA-N

SMILES: O(C(Br)(F)F)C1=CC=C(N(=O)=O)C=C1

Synonyms:

• 1-(Bromodifluoromethoxy)-4-nitrobenzene
• 4-(Bromodifluoromethoxy)nitrobenzene
• Benzene, 1-(bromodifluoromethoxy)-4-nitro-

4-(Bromodifluoromethoxy)nitrobenzene

CAS: 81932-04-9

4-(Bromodifluoromethoxy)nitrobenzene

Purity: 97%

Color and Shape: Liquid

Molecular weight: 268.01g/mol

Ref: 54-PC1393C

4-(Bromodifluoromethoxy)Nitrobenzene

CAS: 81932-04-9

4-(Bromodifluoromethoxy)Nitrobenzene is a versatile building block that can be used to synthesize a wide variety of organic and inorganic compounds. It is a brominated derivative of nitrobenzene, which is useful for the synthesis of complex compounds and research chemicals. 4-(Bromodifluoromethoxy)Nitrobenzene is also an intermediate for the synthesis of pharmaceuticals and other valuable chemical compounds. This compound has been shown to provide high quality results in reactions with other molecules. 4-(Bromodifluoromethoxy)Nitrobenzene can be used as a scaffold for the construction of more complex molecules.

Formula: C₇H₄BrF₂NO₃

Purity: Min. 95%

Color and Shape: Liquid

Molecular weight: 268.01 g/mol

Ref: 3D-FB82917