CymitQuimica logo

CAS 81935-22-0

:

4-Chloro-6-methoxy-2-methyl-1,5-naphthyridine

Description:
4-Chloro-6-methoxy-2-methyl-1,5-naphthyridine is a heterocyclic organic compound characterized by its naphthyridine structure, which consists of a fused bicyclic system containing nitrogen atoms. This compound features a chlorine atom at the 4-position, a methoxy group (-OCH3) at the 6-position, and a methyl group (-CH3) at the 2-position of the naphthyridine ring. The presence of these substituents contributes to its unique chemical properties, including potential reactivity and solubility characteristics. Typically, compounds of this nature may exhibit biological activity, making them of interest in pharmaceutical research. The chlorine atom can influence the compound's electronic properties, while the methoxy group may enhance lipophilicity, affecting its interaction with biological systems. Additionally, the compound's structure suggests potential for various synthetic applications in organic chemistry. As with many heterocycles, it may also participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, depending on the reaction conditions.
Formula:C10H9ClN2O
InChI:InChI=1S/C10H9ClN2O/c1-6-5-7(11)10-8(12-6)3-4-9(13-10)14-2/h3-5H,1-2H3
InChI key:InChIKey=PKEWUGBPJFZZEH-UHFFFAOYSA-N
SMILES:ClC=1C2=C(N=C(C)C1)C=CC(OC)=N2
Synonyms:
  • 1,5-Naphthyridine, 4-chloro-6-methoxy-2-methyl-
  • 4-Chloro-6-methoxy-2-methyl-1,5-naphthyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.