CymitQuimica logo

CAS 81937-29-3

:

4,4'-dicyclohexylbiphenyl

Description:
4,4'-Dicyclohexylbiphenyl, with the CAS number 81937-29-3, is an organic compound characterized by its biphenyl structure, where two phenyl rings are connected by a single bond, and each phenyl ring is substituted with a cyclohexyl group at the para position. This compound is typically a colorless to pale yellow solid at room temperature and is known for its relatively high melting point and low solubility in water, making it more soluble in organic solvents. It exhibits good thermal stability and is often used in applications such as heat transfer fluids, lubricants, and as a component in various chemical syntheses. The presence of cyclohexyl groups contributes to its steric bulk, which can influence its reactivity and interactions with other chemical species. Additionally, 4,4'-dicyclohexylbiphenyl may have applications in materials science, particularly in the development of polymers and other advanced materials due to its unique structural properties.
Formula:C24H30
InChI:InChI=1/C24H30/c1-3-7-19(8-4-1)21-11-15-23(16-12-21)24-17-13-22(14-18-24)20-9-5-2-6-10-20/h11-20H,1-10H2
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.