CAS 81938-67-2
:(3α,5β,7β,12β)-3,7,12-Trihydroxycholan-24-oic acid
Description:
The chemical substance known as (3α,5β,7β,12β)-3,7,12-Trihydroxycholan-24-oic acid, with the CAS number 81938-67-2, is a bile acid derivative, specifically a form of chenodeoxycholic acid. This compound is characterized by the presence of three hydroxyl (-OH) groups at the 3, 7, and 12 positions of the cholane backbone, which is a steroid structure. The presence of these hydroxyl groups contributes to its amphipathic nature, allowing it to interact with both lipophilic and hydrophilic environments, making it essential in the emulsification and absorption of dietary fats. The compound plays a significant role in the metabolism of lipids and is involved in the regulation of cholesterol levels in the body. Additionally, it has been studied for its potential therapeutic effects in various liver and metabolic disorders. Its structural configuration, including stereochemistry, influences its biological activity and interaction with cellular receptors.
Formula:C24H40O5
InChI:InChI=1S/C24H40O5/c1-13(4-7-21(28)29)16-5-6-17-22-18(12-20(27)24(16,17)3)23(2)9-8-15(25)10-14(23)11-19(22)26/h13-20,22,25-27H,4-12H2,1-3H3,(H,28,29)/t13-,14+,15-,16-,17+,18+,19+,20-,22+,23+,24-/m1/s1
InChI key:InChIKey=BHQCQFFYRZLCQQ-BJOVICNYSA-N
SMILES:O[C@@H]1[C@]2([C@]3([C@@](C)([C@@]([C@@H](CCC(O)=O)C)(CC3)[H])[C@H](O)C[C@@]2([C@]4(C)[C@](C1)(C[C@H](O)CC4)[H])[H])[H])[H]
Synonyms:- (3α,5β,7β,12β)-3,7,12-Trihydroxycholan-24-oic acid
- 3a,7b,12b-Trihydroxy-5b-cholanic acid
- 3a,7b,12b-Trihydroxy-5b-cholanoic acid
- Cholan-24-oic acid, 3,7,12-trihydroxy-, (3α,5β,7β,12β)-
- Chenodeoxycholic Acid Impurity 12
- Cholic acid Impurity 5
- (3a,5b,7b,12b)-3,7,12-trihydroxy-Cholan-24-oic acid
- BHQCQFFYRZLCQQ-BJOVICNYSA-N
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
3α,7β,12β-Trihydroxy-5β-cholanoic Acid-d3
CAS:Controlled ProductApplications 3α,7β,12β-Trihydroxy-5β-cholanoic Acid-d3 is the labeled analogue of 3α,7β,12β-Trihydroxy-5β-cholanoic Acid (T795140), a potential bile acid metabolite.
References Ilda, T., Chang, F.C., J. Org. Chem., 47, 2972 (1982)Formula:C24D3H37O5Color and Shape:NeatMolecular weight:411.593α,7β,12β-Trihydroxy-5β-cholanoic Acid
CAS:Controlled ProductFormula:C24H40O5Color and Shape:NeatMolecular weight:408.57
